About fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine
fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine (PubChem CID 173397063) has the molecular formula C16H20FNO3
and a molecular weight of 293.34 g/mol. Its IUPAC name is fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine.
Molecular Properties
| Compound Name | fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine |
| PubChem CID | 173397063 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.Fc1ccccc1.O=C(O)CO |
| InChI | InChI=1S/C8H11N.C6H5F.C2H4O3/c1-7(9)8-5-3-2-4-6-8;7-6-4-2-1-3-5-6;3-1-2(4)5/h2-7H,9H2,1H3;1-5H;3H,1H2,(H,4,5) |
| InChIKey | UAUKYHUFBOICKV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine?
The IUPAC name of fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine (CID 173397063) is fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine.
What is the SMILES notation for fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine?
The canonical SMILES for fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine is CC(N)c1ccccc1.Fc1ccccc1.O=C(O)CO.
What is the InChIKey of fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine?
The InChIKey is UAUKYHUFBOICKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C6H5F.C2H4O3/c1-7(9)8-5-3-2-4-6-8;7-6-4-2-1-3-5-6;3-1-2(4)5/h2-7H,9H2,1H3;1-5H;3H,1H2,(H,4,5).
What are the key properties of fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine?
fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine has a molecular weight of 293.34 g/mol, XLogP of 2.60, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;2-hydroxyacetic acid;1-phenylethanamine is sourced from PubChem (CID 173397063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).