C17H19F3N2O2 — CID 161490780
(1R)-1-phenylethanamine;2-(2,3,4-trifluoroanilino)propanoic acid (PubChem CID 161490780) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is (1R)-1-phenylethanamine;2-(2,3,4-trifluoroanilino)propanoic acid.
| Compound Name | (1R)-1-phenylethanamine;2-(2,3,4-trifluoroanilino)propanoic acid |
|---|---|
| PubChem CID | 161490780 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (1R)-1-phenylethanamine;2-(2,3,4-trifluoroanilino)propanoic acid |
| SMILES | CC(Nc1ccc(F)c(F)c1F)C(=O)O.C[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C9H8F3NO2.C8H11N/c1-4(9(14)15)13-6-3-2-5(10)7(11)8(6)12;1-7(9)8-5-3-2-4-6-8/h2-4,13H,1H3,(H,14,15);2-7H,9H2,1H3/t;7-/m.1/s1 |
| InChIKey | WFOPSOLULKNXDH-HMZWWLAASA-N |
| XLogP | 3.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|