About ethane;(1R)-1-phenylethanamine
ethane;(1R)-1-phenylethanamine (PubChem CID 142977390) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is ethane;(1R)-1-phenylethanamine.
Molecular Properties
| Compound Name | ethane;(1R)-1-phenylethanamine |
| PubChem CID | 142977390 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | ethane;(1R)-1-phenylethanamine |
| SMILES | CC.C[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C8H11N.C2H6/c1-7(9)8-5-3-2-4-6-8;1-2/h2-7H,9H2,1H3;1-2H3/t7-;/m1./s1 |
| InChIKey | WWCXBTYKXJXCSP-OGFXRTJISA-N |
| XLogP | 2.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(1R)-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1R)-1-phenylethanamine?
The IUPAC name of ethane;(1R)-1-phenylethanamine (CID 142977390) is ethane;(1R)-1-phenylethanamine.
What is the SMILES notation for ethane;(1R)-1-phenylethanamine?
The canonical SMILES for ethane;(1R)-1-phenylethanamine is CC.C[C@@H](N)c1ccccc1.
What is the InChIKey of ethane;(1R)-1-phenylethanamine?
The InChIKey is WWCXBTYKXJXCSP-OGFXRTJISA-N. The full InChI is InChI=1S/C8H11N.C2H6/c1-7(9)8-5-3-2-4-6-8;1-2/h2-7H,9H2,1H3;1-2H3/t7-;/m1./s1.
What are the key properties of ethane;(1R)-1-phenylethanamine?
ethane;(1R)-1-phenylethanamine has a molecular weight of 151.25 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1R)-1-phenylethanamine is sourced from PubChem (CID 142977390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).