About 1-phenylethanamine;toluene
1-phenylethanamine;toluene (PubChem CID 143029898) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-phenylethanamine;toluene.
Molecular Properties
| Compound Name | 1-phenylethanamine;toluene |
| PubChem CID | 143029898 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-phenylethanamine;toluene |
| SMILES | CC(N)c1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C8H11N.C7H8/c1-7(9)8-5-3-2-4-6-8;1-7-5-3-2-4-6-7/h2-7H,9H2,1H3;2-6H,1H3 |
| InChIKey | BGGPHSPLEDPUHX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylethanamine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanamine;toluene?
The IUPAC name of 1-phenylethanamine;toluene (CID 143029898) is 1-phenylethanamine;toluene.
What is the SMILES notation for 1-phenylethanamine;toluene?
The canonical SMILES for 1-phenylethanamine;toluene is CC(N)c1ccccc1.Cc1ccccc1.
What is the InChIKey of 1-phenylethanamine;toluene?
The InChIKey is BGGPHSPLEDPUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C7H8/c1-7(9)8-5-3-2-4-6-8;1-7-5-3-2-4-6-7/h2-7H,9H2,1H3;2-6H,1H3.
What are the key properties of 1-phenylethanamine;toluene?
1-phenylethanamine;toluene has a molecular weight of 213.32 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanamine;toluene is sourced from PubChem (CID 143029898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).