About (1R)-1-phenylethanamine;propan-2-one
(1R)-1-phenylethanamine;propan-2-one (PubChem CID 54416751) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (1R)-1-phenylethanamine;propan-2-one.
Molecular Properties
| Compound Name | (1R)-1-phenylethanamine;propan-2-one |
| PubChem CID | 54416751 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1R)-1-phenylethanamine;propan-2-one |
| SMILES | CC(C)=O.C[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C8H11N.C3H6O/c1-7(9)8-5-3-2-4-6-8;1-3(2)4/h2-7H,9H2,1H3;1-2H3/t7-;/m1./s1 |
| InChIKey | VXZLQBUOPDLLEJ-OGFXRTJISA-N |
| XLogP | 2.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-phenylethanamine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-phenylethanamine;propan-2-one?
The IUPAC name of (1R)-1-phenylethanamine;propan-2-one (CID 54416751) is (1R)-1-phenylethanamine;propan-2-one.
What is the SMILES notation for (1R)-1-phenylethanamine;propan-2-one?
The canonical SMILES for (1R)-1-phenylethanamine;propan-2-one is CC(C)=O.C[C@@H](N)c1ccccc1.
What is the InChIKey of (1R)-1-phenylethanamine;propan-2-one?
The InChIKey is VXZLQBUOPDLLEJ-OGFXRTJISA-N. The full InChI is InChI=1S/C8H11N.C3H6O/c1-7(9)8-5-3-2-4-6-8;1-3(2)4/h2-7H,9H2,1H3;1-2H3/t7-;/m1./s1.
What are the key properties of (1R)-1-phenylethanamine;propan-2-one?
(1R)-1-phenylethanamine;propan-2-one has a molecular weight of 179.26 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-phenylethanamine;propan-2-one is sourced from PubChem (CID 54416751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).