About 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine
1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine (PubChem CID 172954203) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine.
Molecular Properties
| Compound Name | 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine |
| PubChem CID | 172954203 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine |
| SMILES | C/C(=N/O)c1ccccc1.CC(=O)c1ccccc1.CC(N)c1ccccc1 |
| InChI | InChI=1S/C8H9NO.C8H11N.C8H8O/c1-7(9-10)8-5-3-2-4-6-8;2*1-7(9)8-5-3-2-4-6-8/h2-6,10H,1H3;2-7H,9H2,1H3;2-6H,1H3/b9-7-;; |
| InChIKey | QJKYGAOARYAFEK-COUYFGMESA-N |
| XLogP | 5.48 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine?
The IUPAC name of 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine (CID 172954203) is 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine.
What is the SMILES notation for 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine?
The canonical SMILES for 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine is C/C(=N/O)c1ccccc1.CC(=O)c1ccccc1.CC(N)c1ccccc1.
What is the InChIKey of 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine?
The InChIKey is QJKYGAOARYAFEK-COUYFGMESA-N. The full InChI is InChI=1S/C8H9NO.C8H11N.C8H8O/c1-7(9-10)8-5-3-2-4-6-8;2*1-7(9)8-5-3-2-4-6-8/h2-6,10H,1H3;2-7H,9H2,1H3;2-6H,1H3/b9-7-;;.
What are the key properties of 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine?
1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine has a molecular weight of 376.50 g/mol, XLogP of 5.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanamine;1-phenylethanone;(NZ)-N-(1-phenylethylidene)hydroxylamine is sourced from PubChem (CID 172954203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).