About (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine
(2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine (PubChem CID 162087543) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine.
Molecular Properties
| Compound Name | (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine |
| PubChem CID | 162087543 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine |
| SMILES | C[C@@H](C(=O)O)c1ccc(O)cc1.C[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C9H10O3.C8H11N/c1-6(9(11)12)7-2-4-8(10)5-3-7;1-7(9)8-5-3-2-4-6-8/h2-6,10H,1H3,(H,11,12);2-7H,9H2,1H3/t6-;7-/m10/s1 |
| InChIKey | ZDEAYUJFOMJRJH-NBFIYYEBSA-N |
| XLogP | 3.29 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine?
The IUPAC name of (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine (CID 162087543) is (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine.
What is the SMILES notation for (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine?
The canonical SMILES for (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine is C[C@@H](C(=O)O)c1ccc(O)cc1.C[C@H](N)c1ccccc1.
What is the InChIKey of (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine?
The InChIKey is ZDEAYUJFOMJRJH-NBFIYYEBSA-N. The full InChI is InChI=1S/C9H10O3.C8H11N/c1-6(9(11)12)7-2-4-8(10)5-3-7;1-7(9)8-5-3-2-4-6-8/h2-6,10H,1H3,(H,11,12);2-7H,9H2,1H3/t6-;7-/m10/s1.
What are the key properties of (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine?
(2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine has a molecular weight of 287.36 g/mol, XLogP of 3.29, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-hydroxyphenyl)propanoic acid;(1S)-1-phenylethanamine is sourced from PubChem (CID 162087543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).