C12H17NO6 — CID 127256278
4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid (PubChem CID 127256278) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid.
| Compound Name | 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 127256278 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid |
| SMILES | C[C@H](N)c1ccc(O)cc1.O=C(O)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C8H11NO.C4H6O5/c1-6(9)7-2-4-8(10)5-3-7;5-2(4(8)9)1-3(6)7/h2-6,10H,9H2,1H3;2,5H,1H2,(H,6,7)(H,8,9)/t6-;2-/m01/s1 |
| InChIKey | DAXZTBVSSNGGTB-DUDYXQCISA-N |
| XLogP | 0.32 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |