About 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid
4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid (PubChem CID 127256278) has the molecular formula C12H17NO6
and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid.
Molecular Properties
| Compound Name | 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid |
| PubChem CID | 127256278 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid |
| SMILES | C[C@H](N)c1ccc(O)cc1.O=C(O)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C8H11NO.C4H6O5/c1-6(9)7-2-4-8(10)5-3-7;5-2(4(8)9)1-3(6)7/h2-6,10H,9H2,1H3;2,5H,1H2,(H,6,7)(H,8,9)/t6-;2-/m01/s1 |
| InChIKey | DAXZTBVSSNGGTB-DUDYXQCISA-N |
| XLogP | 0.32 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid?
The IUPAC name of 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid (CID 127256278) is 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid.
What is the SMILES notation for 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid?
The canonical SMILES for 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid is C[C@H](N)c1ccc(O)cc1.O=C(O)C[C@@H](O)C(=O)O.
What is the InChIKey of 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid?
The InChIKey is DAXZTBVSSNGGTB-DUDYXQCISA-N. The full InChI is InChI=1S/C8H11NO.C4H6O5/c1-6(9)7-2-4-8(10)5-3-7;5-2(4(8)9)1-3(6)7/h2-6,10H,9H2,1H3;2,5H,1H2,(H,6,7)(H,8,9)/t6-;2-/m01/s1.
What are the key properties of 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid?
4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid has a molecular weight of 271.27 g/mol, XLogP of 0.32, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-1-aminoethyl]phenol;(2R)-2-hydroxybutanedioic acid is sourced from PubChem (CID 127256278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).