About azane;bismuthane;2-hydroxybutanedioic acid
azane;bismuthane;2-hydroxybutanedioic acid (PubChem CID 173447177) has the molecular formula C4H12BiNO5
and a molecular weight of 363.12 g/mol. Its IUPAC name is azane;bismuthane;2-hydroxybutanedioic acid.
Molecular Properties
| Compound Name | azane;bismuthane;2-hydroxybutanedioic acid |
| PubChem CID | 173447177 |
| Molecular Formula | C4H12BiNO5 |
| Molecular Weight | 363.12 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | azane;bismuthane;2-hydroxybutanedioic acid |
| SMILES | N.O=C(O)CC(O)C(=O)O.[BiH3] |
| InChI | InChI=1S/C4H6O5.Bi.H3N.3H/c5-2(4(8)9)1-3(6)7;;;;;/h2,5H,1H2,(H,6,7)(H,8,9);;1H3;;; |
| InChIKey | OGGXZDWEDALCJU-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.12 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;bismuthane;2-hydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bismuthane;2-hydroxybutanedioic acid?
The IUPAC name of azane;bismuthane;2-hydroxybutanedioic acid (CID 173447177) is azane;bismuthane;2-hydroxybutanedioic acid.
What is the SMILES notation for azane;bismuthane;2-hydroxybutanedioic acid?
The canonical SMILES for azane;bismuthane;2-hydroxybutanedioic acid is N.O=C(O)CC(O)C(=O)O.[BiH3].
What is the InChIKey of azane;bismuthane;2-hydroxybutanedioic acid?
The InChIKey is OGGXZDWEDALCJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.Bi.H3N.3H/c5-2(4(8)9)1-3(6)7;;;;;/h2,5H,1H2,(H,6,7)(H,8,9);;1H3;;;.
What are the key properties of azane;bismuthane;2-hydroxybutanedioic acid?
azane;bismuthane;2-hydroxybutanedioic acid has a molecular weight of 363.12 g/mol, XLogP of -2.12, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bismuthane;2-hydroxybutanedioic acid is sourced from PubChem (CID 173447177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).