2-aminoacetic acid;2-hydroxybutanedioic acid

C6H11NO7 — CID 87750134

IUPAC2-aminoacetic acid;2-hydroxybutanedioic acid
SMILESNCC(=O)O.O=C(O)CC(O)C(=O)O
InChIInChI=1S/C4H6O5.C2H5NO2/c5-2(4(8)9)1-3(6)7;3-1-2(4)5/h2,5H,1H2,(H,6,7)(H,8,9);1,3H2,(H,4,5)
InChIKeyDSIWIUIMODGYQQ-UHFFFAOYSA-N
MW209.15 g/mol
LogP-2.06
Rot. Bonds4

About 2-aminoacetic acid;2-hydroxybutanedioic acid

2-aminoacetic acid;2-hydroxybutanedioic acid (PubChem CID 87750134) has the molecular formula C6H11NO7 and a molecular weight of 209.15 g/mol. Its IUPAC name is 2-aminoacetic acid;2-hydroxybutanedioic acid.

Molecular Properties

Compound Name2-aminoacetic acid;2-hydroxybutanedioic acid
PubChem CID87750134
Molecular FormulaC6H11NO7
Molecular Weight209.15 g/mol
Exact Mass209.05
IUPAC Name2-aminoacetic acid;2-hydroxybutanedioic acid
SMILESNCC(=O)O.O=C(O)CC(O)C(=O)O
InChIInChI=1S/C4H6O5.C2H5NO2/c5-2(4(8)9)1-3(6)7;3-1-2(4)5/h2,5H,1H2,(H,6,7)(H,8,9);1,3H2,(H,4,5)
InChIKeyDSIWIUIMODGYQQ-UHFFFAOYSA-N
XLogP-2.06
TPSA158.15 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.15
LogP ≤ 5-2.06
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2-aminoacetic acid;2-hydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoacetic acid;2-hydroxybutanedioic acid?
The IUPAC name of 2-aminoacetic acid;2-hydroxybutanedioic acid (CID 87750134) is 2-aminoacetic acid;2-hydroxybutanedioic acid.
What is the SMILES notation for 2-aminoacetic acid;2-hydroxybutanedioic acid?
The canonical SMILES for 2-aminoacetic acid;2-hydroxybutanedioic acid is NCC(=O)O.O=C(O)CC(O)C(=O)O.
What is the InChIKey of 2-aminoacetic acid;2-hydroxybutanedioic acid?
The InChIKey is DSIWIUIMODGYQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.C2H5NO2/c5-2(4(8)9)1-3(6)7;3-1-2(4)5/h2,5H,1H2,(H,6,7)(H,8,9);1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;2-hydroxybutanedioic acid?
2-aminoacetic acid;2-hydroxybutanedioic acid has a molecular weight of 209.15 g/mol, XLogP of -2.06, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;2-hydroxybutanedioic acid is sourced from PubChem (CID 87750134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).