C6H11NO7 — CID 87750134
2-aminoacetic acid;2-hydroxybutanedioic acid (PubChem CID 87750134) has the molecular formula C6H11NO7 and a molecular weight of 209.15 g/mol. Its IUPAC name is 2-aminoacetic acid;2-hydroxybutanedioic acid.
| Compound Name | 2-aminoacetic acid;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87750134 |
| Molecular Formula | C6H11NO7 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-aminoacetic acid;2-hydroxybutanedioic acid |
| SMILES | NCC(=O)O.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O5.C2H5NO2/c5-2(4(8)9)1-3(6)7;3-1-2(4)5/h2,5H,1H2,(H,6,7)(H,8,9);1,3H2,(H,4,5) |
| InChIKey | DSIWIUIMODGYQQ-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |