About 2-hydroxybutanedioic acid;iron
2-hydroxybutanedioic acid;iron (PubChem CID 174146167) has the molecular formula C4H6Fe2O5
and a molecular weight of 245.78 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;iron.
Molecular Properties
| Compound Name | 2-hydroxybutanedioic acid;iron |
| PubChem CID | 174146167 |
| Molecular Formula | C4H6Fe2O5 |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.89 |
| IUPAC Name | 2-hydroxybutanedioic acid;iron |
| SMILES | O=C(O)CC(O)C(=O)O.[Fe].[Fe] |
| InChI | InChI=1S/C4H6O5.2Fe/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);; |
| InChIKey | OQCKOFHNFCEEPF-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanedioic acid;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanedioic acid;iron?
The IUPAC name of 2-hydroxybutanedioic acid;iron (CID 174146167) is 2-hydroxybutanedioic acid;iron.
What is the SMILES notation for 2-hydroxybutanedioic acid;iron?
The canonical SMILES for 2-hydroxybutanedioic acid;iron is O=C(O)CC(O)C(=O)O.[Fe].[Fe].
What is the InChIKey of 2-hydroxybutanedioic acid;iron?
The InChIKey is OQCKOFHNFCEEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.2Fe/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);;.
What are the key properties of 2-hydroxybutanedioic acid;iron?
2-hydroxybutanedioic acid;iron has a molecular weight of 245.78 g/mol, XLogP of -1.10, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedioic acid;iron is sourced from PubChem (CID 174146167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).