acetic acid;copper;2-hydroxybutanedioic acid

C6H10CuO7 — CID 175107089

IUPACacetic acid;copper;2-hydroxybutanedioic acid
SMILESCC(=O)O.O=C(O)CC(O)C(=O)O.[Cu]
InChIInChI=1S/C4H6O5.C2H4O2.Cu/c5-2(4(8)9)1-3(6)7;1-2(3)4;/h2,5H,1H2,(H,6,7)(H,8,9);1H3,(H,3,4);
InChIKeyVIZDISLZYRFYHJ-UHFFFAOYSA-N
MW257.68 g/mol
LogP-1.00
Rot. Bonds3

About acetic acid;copper;2-hydroxybutanedioic acid

acetic acid;copper;2-hydroxybutanedioic acid (PubChem CID 175107089) has the molecular formula C6H10CuO7 and a molecular weight of 257.68 g/mol. Its IUPAC name is acetic acid;copper;2-hydroxybutanedioic acid.

Molecular Properties

Compound Nameacetic acid;copper;2-hydroxybutanedioic acid
PubChem CID175107089
Molecular FormulaC6H10CuO7
Molecular Weight257.68 g/mol
Exact Mass256.97
IUPAC Nameacetic acid;copper;2-hydroxybutanedioic acid
SMILESCC(=O)O.O=C(O)CC(O)C(=O)O.[Cu]
InChIInChI=1S/C4H6O5.C2H4O2.Cu/c5-2(4(8)9)1-3(6)7;1-2(3)4;/h2,5H,1H2,(H,6,7)(H,8,9);1H3,(H,3,4);
InChIKeyVIZDISLZYRFYHJ-UHFFFAOYSA-N
XLogP-1.00
TPSA132.13 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.68
LogP ≤ 5-1.00
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze acetic acid;copper;2-hydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;copper;2-hydroxybutanedioic acid?
The IUPAC name of acetic acid;copper;2-hydroxybutanedioic acid (CID 175107089) is acetic acid;copper;2-hydroxybutanedioic acid.
What is the SMILES notation for acetic acid;copper;2-hydroxybutanedioic acid?
The canonical SMILES for acetic acid;copper;2-hydroxybutanedioic acid is CC(=O)O.O=C(O)CC(O)C(=O)O.[Cu].
What is the InChIKey of acetic acid;copper;2-hydroxybutanedioic acid?
The InChIKey is VIZDISLZYRFYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.C2H4O2.Cu/c5-2(4(8)9)1-3(6)7;1-2(3)4;/h2,5H,1H2,(H,6,7)(H,8,9);1H3,(H,3,4);.
What are the key properties of acetic acid;copper;2-hydroxybutanedioic acid?
acetic acid;copper;2-hydroxybutanedioic acid has a molecular weight of 257.68 g/mol, XLogP of -1.00, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;copper;2-hydroxybutanedioic acid is sourced from PubChem (CID 175107089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).