C6H10CuO7 — CID 175107089
acetic acid;copper;2-hydroxybutanedioic acid (PubChem CID 175107089) has the molecular formula C6H10CuO7 and a molecular weight of 257.68 g/mol. Its IUPAC name is acetic acid;copper;2-hydroxybutanedioic acid.
| Compound Name | acetic acid;copper;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175107089 |
| Molecular Formula | C6H10CuO7 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | acetic acid;copper;2-hydroxybutanedioic acid |
| SMILES | CC(=O)O.O=C(O)CC(O)C(=O)O.[Cu] |
| InChI | InChI=1S/C4H6O5.C2H4O2.Cu/c5-2(4(8)9)1-3(6)7;1-2(3)4;/h2,5H,1H2,(H,6,7)(H,8,9);1H3,(H,3,4); |
| InChIKey | VIZDISLZYRFYHJ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |