About 2-phenylpropanoic acid;dihydrochloride
2-phenylpropanoic acid;dihydrochloride (PubChem CID 162109025) has the molecular formula C9H12Cl2O2
and a molecular weight of 223.10 g/mol. Its IUPAC name is 2-phenylpropanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-phenylpropanoic acid;dihydrochloride |
| PubChem CID | 162109025 |
| Molecular Formula | C9H12Cl2O2 |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 2-phenylpropanoic acid;dihydrochloride |
| SMILES | CC(C(=O)O)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C9H10O2.2ClH/c1-7(9(10)11)8-5-3-2-4-6-8;;/h2-7H,1H3,(H,10,11);2*1H |
| InChIKey | ZFWZDHYZGCVGPP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylpropanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropanoic acid;dihydrochloride?
The IUPAC name of 2-phenylpropanoic acid;dihydrochloride (CID 162109025) is 2-phenylpropanoic acid;dihydrochloride.
What is the SMILES notation for 2-phenylpropanoic acid;dihydrochloride?
The canonical SMILES for 2-phenylpropanoic acid;dihydrochloride is CC(C(=O)O)c1ccccc1.Cl.Cl.
What is the InChIKey of 2-phenylpropanoic acid;dihydrochloride?
The InChIKey is ZFWZDHYZGCVGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.2ClH/c1-7(9(10)11)8-5-3-2-4-6-8;;/h2-7H,1H3,(H,10,11);2*1H.
What are the key properties of 2-phenylpropanoic acid;dihydrochloride?
2-phenylpropanoic acid;dihydrochloride has a molecular weight of 223.10 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropanoic acid;dihydrochloride is sourced from PubChem (CID 162109025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).