About 2-phenylpropanoic acid;hydrate
2-phenylpropanoic acid;hydrate (PubChem CID 139796091) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-phenylpropanoic acid;hydrate.
Molecular Properties
| Compound Name | 2-phenylpropanoic acid;hydrate |
| PubChem CID | 139796091 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-phenylpropanoic acid;hydrate |
| SMILES | CC(C(=O)O)c1ccccc1.O |
| InChI | InChI=1S/C9H10O2.H2O/c1-7(9(10)11)8-5-3-2-4-6-8;/h2-7H,1H3,(H,10,11);1H2 |
| InChIKey | QMXBVYWNRFSKOA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylpropanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropanoic acid;hydrate?
The IUPAC name of 2-phenylpropanoic acid;hydrate (CID 139796091) is 2-phenylpropanoic acid;hydrate.
What is the SMILES notation for 2-phenylpropanoic acid;hydrate?
The canonical SMILES for 2-phenylpropanoic acid;hydrate is CC(C(=O)O)c1ccccc1.O.
What is the InChIKey of 2-phenylpropanoic acid;hydrate?
The InChIKey is QMXBVYWNRFSKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.H2O/c1-7(9(10)11)8-5-3-2-4-6-8;/h2-7H,1H3,(H,10,11);1H2.
What are the key properties of 2-phenylpropanoic acid;hydrate?
2-phenylpropanoic acid;hydrate has a molecular weight of 168.19 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropanoic acid;hydrate is sourced from PubChem (CID 139796091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).