About methane;(2R)-2-phenylpropanoic acid
methane;(2R)-2-phenylpropanoic acid (PubChem CID 162174165) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is methane;(2R)-2-phenylpropanoic acid.
Molecular Properties
| Compound Name | methane;(2R)-2-phenylpropanoic acid |
| PubChem CID | 162174165 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | methane;(2R)-2-phenylpropanoic acid |
| SMILES | C.C[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H10O2.CH4/c1-7(9(10)11)8-5-3-2-4-6-8;/h2-7H,1H3,(H,10,11);1H4/t7-;/m1./s1 |
| InChIKey | ZOEBLUYOTSKXAC-OGFXRTJISA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;(2R)-2-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(2R)-2-phenylpropanoic acid?
The IUPAC name of methane;(2R)-2-phenylpropanoic acid (CID 162174165) is methane;(2R)-2-phenylpropanoic acid.
What is the SMILES notation for methane;(2R)-2-phenylpropanoic acid?
The canonical SMILES for methane;(2R)-2-phenylpropanoic acid is C.C[C@@H](C(=O)O)c1ccccc1.
What is the InChIKey of methane;(2R)-2-phenylpropanoic acid?
The InChIKey is ZOEBLUYOTSKXAC-OGFXRTJISA-N. The full InChI is InChI=1S/C9H10O2.CH4/c1-7(9(10)11)8-5-3-2-4-6-8;/h2-7H,1H3,(H,10,11);1H4/t7-;/m1./s1.
What are the key properties of methane;(2R)-2-phenylpropanoic acid?
methane;(2R)-2-phenylpropanoic acid has a molecular weight of 166.22 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(2R)-2-phenylpropanoic acid is sourced from PubChem (CID 162174165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).