About 3-isocyanopropanoic acid;1-phenylethanamine
3-isocyanopropanoic acid;1-phenylethanamine (PubChem CID 88788134) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-isocyanopropanoic acid;1-phenylethanamine.
Molecular Properties
| Compound Name | 3-isocyanopropanoic acid;1-phenylethanamine |
| PubChem CID | 88788134 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-isocyanopropanoic acid;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.[C-]#[N+]CCC(=O)O |
| InChI | InChI=1S/C8H11N.C4H5NO2/c1-7(9)8-5-3-2-4-6-8;1-5-3-2-4(6)7/h2-7H,9H2,1H3;2-3H2,(H,6,7) |
| InChIKey | AOCAXBXRZMLEBU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanopropanoic acid;1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanopropanoic acid;1-phenylethanamine?
The IUPAC name of 3-isocyanopropanoic acid;1-phenylethanamine (CID 88788134) is 3-isocyanopropanoic acid;1-phenylethanamine.
What is the SMILES notation for 3-isocyanopropanoic acid;1-phenylethanamine?
The canonical SMILES for 3-isocyanopropanoic acid;1-phenylethanamine is CC(N)c1ccccc1.[C-]#[N+]CCC(=O)O.
What is the InChIKey of 3-isocyanopropanoic acid;1-phenylethanamine?
The InChIKey is AOCAXBXRZMLEBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C4H5NO2/c1-7(9)8-5-3-2-4-6-8;1-5-3-2-4(6)7/h2-7H,9H2,1H3;2-3H2,(H,6,7).
What are the key properties of 3-isocyanopropanoic acid;1-phenylethanamine?
3-isocyanopropanoic acid;1-phenylethanamine has a molecular weight of 220.27 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanopropanoic acid;1-phenylethanamine is sourced from PubChem (CID 88788134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).