About [(2R)-2-phenylpropyl] carbamate
[(2R)-2-phenylpropyl] carbamate (PubChem CID 175384997) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is [(2R)-2-phenylpropyl] carbamate.
Molecular Properties
| Compound Name | [(2R)-2-phenylpropyl] carbamate |
| PubChem CID | 175384997 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | [(2R)-2-phenylpropyl] carbamate |
| SMILES | C[C@@H](COC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c1-8(7-13-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,11,12)/t8-/m0/s1 |
| InChIKey | IHSZWXSZYXCSCX-QMMMGPOBSA-N |
| XLogP | 1.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-2-phenylpropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-phenylpropyl] carbamate?
The IUPAC name of [(2R)-2-phenylpropyl] carbamate (CID 175384997) is [(2R)-2-phenylpropyl] carbamate.
What is the SMILES notation for [(2R)-2-phenylpropyl] carbamate?
The canonical SMILES for [(2R)-2-phenylpropyl] carbamate is C[C@@H](COC(N)=O)c1ccccc1.
What is the InChIKey of [(2R)-2-phenylpropyl] carbamate?
The InChIKey is IHSZWXSZYXCSCX-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H13NO2/c1-8(7-13-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,11,12)/t8-/m0/s1.
What are the key properties of [(2R)-2-phenylpropyl] carbamate?
[(2R)-2-phenylpropyl] carbamate has a molecular weight of 179.22 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-phenylpropyl] carbamate is sourced from PubChem (CID 175384997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).