About (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate
(3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate (PubChem CID 23581812) has the molecular formula C11H16N2O5
and a molecular weight of 256.26 g/mol. Its IUPAC name is (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate.
Molecular Properties
| Compound Name | (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate |
| PubChem CID | 23581812 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate |
| SMILES | NC(=O)OCC(COC(N)=O)c1ccccc1.O |
| InChI | InChI=1S/C11H14N2O4.H2O/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8;/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15);1H2 |
| InChIKey | SURCBXDHJRINFW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 136.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate?
The IUPAC name of (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate (CID 23581812) is (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate.
What is the SMILES notation for (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate?
The canonical SMILES for (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate is NC(=O)OCC(COC(N)=O)c1ccccc1.O.
What is the InChIKey of (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate?
The InChIKey is SURCBXDHJRINFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4.H2O/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8;/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15);1H2.
What are the key properties of (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate?
(3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate has a molecular weight of 256.26 g/mol, XLogP of 0.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoyloxy-2-phenylpropyl) carbamate;hydrate is sourced from PubChem (CID 23581812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).