About carbamic acid;(3-hydroxy-2-phenylpropyl) acetate
carbamic acid;(3-hydroxy-2-phenylpropyl) acetate (PubChem CID 67572448) has the molecular formula C12H17NO5
and a molecular weight of 255.27 g/mol. Its IUPAC name is carbamic acid;(3-hydroxy-2-phenylpropyl) acetate.
Molecular Properties
| Compound Name | carbamic acid;(3-hydroxy-2-phenylpropyl) acetate |
| PubChem CID | 67572448 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | carbamic acid;(3-hydroxy-2-phenylpropyl) acetate |
| SMILES | CC(=O)OCC(CO)c1ccccc1.NC(=O)O |
| InChI | InChI=1S/C11H14O3.CH3NO2/c1-9(13)14-8-11(7-12)10-5-3-2-4-6-10;2-1(3)4/h2-6,11-12H,7-8H2,1H3;2H2,(H,3,4) |
| InChIKey | KQBRSRYXTWOIPJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbamic acid;(3-hydroxy-2-phenylpropyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;(3-hydroxy-2-phenylpropyl) acetate?
The IUPAC name of carbamic acid;(3-hydroxy-2-phenylpropyl) acetate (CID 67572448) is carbamic acid;(3-hydroxy-2-phenylpropyl) acetate.
What is the SMILES notation for carbamic acid;(3-hydroxy-2-phenylpropyl) acetate?
The canonical SMILES for carbamic acid;(3-hydroxy-2-phenylpropyl) acetate is CC(=O)OCC(CO)c1ccccc1.NC(=O)O.
What is the InChIKey of carbamic acid;(3-hydroxy-2-phenylpropyl) acetate?
The InChIKey is KQBRSRYXTWOIPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3.CH3NO2/c1-9(13)14-8-11(7-12)10-5-3-2-4-6-10;2-1(3)4/h2-6,11-12H,7-8H2,1H3;2H2,(H,3,4).
What are the key properties of carbamic acid;(3-hydroxy-2-phenylpropyl) acetate?
carbamic acid;(3-hydroxy-2-phenylpropyl) acetate has a molecular weight of 255.27 g/mol, XLogP of 0.95, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;(3-hydroxy-2-phenylpropyl) acetate is sourced from PubChem (CID 67572448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).