About (3-amino-2-phenylpropyl) 2-aminoacetate
(3-amino-2-phenylpropyl) 2-aminoacetate (PubChem CID 174564415) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is (3-amino-2-phenylpropyl) 2-aminoacetate.
Molecular Properties
| Compound Name | (3-amino-2-phenylpropyl) 2-aminoacetate |
| PubChem CID | 174564415 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (3-amino-2-phenylpropyl) 2-aminoacetate |
| SMILES | NCC(=O)OCC(CN)c1ccccc1 |
| InChI | InChI=1S/C11H16N2O2/c12-6-10(8-15-11(14)7-13)9-4-2-1-3-5-9/h1-5,10H,6-8,12-13H2 |
| InChIKey | GZDSWJXDASABGX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-amino-2-phenylpropyl) 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2-phenylpropyl) 2-aminoacetate?
The IUPAC name of (3-amino-2-phenylpropyl) 2-aminoacetate (CID 174564415) is (3-amino-2-phenylpropyl) 2-aminoacetate.
What is the SMILES notation for (3-amino-2-phenylpropyl) 2-aminoacetate?
The canonical SMILES for (3-amino-2-phenylpropyl) 2-aminoacetate is NCC(=O)OCC(CN)c1ccccc1.
What is the InChIKey of (3-amino-2-phenylpropyl) 2-aminoacetate?
The InChIKey is GZDSWJXDASABGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c12-6-10(8-15-11(14)7-13)9-4-2-1-3-5-9/h1-5,10H,6-8,12-13H2.
What are the key properties of (3-amino-2-phenylpropyl) 2-aminoacetate?
(3-amino-2-phenylpropyl) 2-aminoacetate has a molecular weight of 208.26 g/mol, XLogP of 0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2-phenylpropyl) 2-aminoacetate is sourced from PubChem (CID 174564415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).