About [(1S)-1-phenylethyl] 2-aminoacetate
[(1S)-1-phenylethyl] 2-aminoacetate (PubChem CID 92978574) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 2-aminoacetate.
Molecular Properties
| Compound Name | [(1S)-1-phenylethyl] 2-aminoacetate |
| PubChem CID | 92978574 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | [(1S)-1-phenylethyl] 2-aminoacetate |
| SMILES | C[C@H](OC(=O)CN)c1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c1-8(13-10(12)7-11)9-5-3-2-4-6-9/h2-6,8H,7,11H2,1H3/t8-/m0/s1 |
| InChIKey | CYUJEVOKDUGCSL-QMMMGPOBSA-N |
| XLogP | 1.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-1-phenylethyl] 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylethyl] 2-aminoacetate?
The IUPAC name of [(1S)-1-phenylethyl] 2-aminoacetate (CID 92978574) is [(1S)-1-phenylethyl] 2-aminoacetate.
What is the SMILES notation for [(1S)-1-phenylethyl] 2-aminoacetate?
The canonical SMILES for [(1S)-1-phenylethyl] 2-aminoacetate is C[C@H](OC(=O)CN)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylethyl] 2-aminoacetate?
The InChIKey is CYUJEVOKDUGCSL-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H13NO2/c1-8(13-10(12)7-11)9-5-3-2-4-6-9/h2-6,8H,7,11H2,1H3/t8-/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] 2-aminoacetate?
[(1S)-1-phenylethyl] 2-aminoacetate has a molecular weight of 179.22 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] 2-aminoacetate is sourced from PubChem (CID 92978574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).