About [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate
[(1S)-1-phenylethyl] N-(aminomethoxy)carbamate (PubChem CID 139568949) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate.
Molecular Properties
| Compound Name | [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate |
| PubChem CID | 139568949 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate |
| SMILES | C[C@H](OC(=O)NOCN)c1ccccc1 |
| InChI | InChI=1S/C10H14N2O3/c1-8(9-5-3-2-4-6-9)15-10(13)12-14-7-11/h2-6,8H,7,11H2,1H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | QRKRMVCUQUHUFV-QMMMGPOBSA-N |
| XLogP | 1.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate?
The IUPAC name of [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate (CID 139568949) is [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate.
What is the SMILES notation for [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate?
The canonical SMILES for [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate is C[C@H](OC(=O)NOCN)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate?
The InChIKey is QRKRMVCUQUHUFV-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-8(9-5-3-2-4-6-9)15-10(13)12-14-7-11/h2-6,8H,7,11H2,1H3,(H,12,13)/t8-/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate?
[(1S)-1-phenylethyl] N-(aminomethoxy)carbamate has a molecular weight of 210.23 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] N-(aminomethoxy)carbamate is sourced from PubChem (CID 139568949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).