C12H15NO2 — CID 67912904
1-phenylethyl N-prop-2-enylcarbamate (PubChem CID 67912904) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-phenylethyl N-prop-2-enylcarbamate.
| Compound Name | 1-phenylethyl N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 67912904 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-phenylethyl N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-3-9-13-12(14)15-10(2)11-7-5-4-6-8-11/h3-8,10H,1,9H2,2H3,(H,13,14) |
| InChIKey | JXRLBACMRVWMKX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|