About [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate
[(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate (PubChem CID 156899526) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate.
Molecular Properties
| Compound Name | [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate |
| PubChem CID | 156899526 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate |
| SMILES | C[C@H](OC(=O)NC/C=C/CN)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O2/c1-11(12-7-3-2-4-8-12)17-13(16)15-10-6-5-9-14/h2-8,11H,9-10,14H2,1H3,(H,15,16)/b6-5+/t11-/m0/s1 |
| InChIKey | JZUTYMVXCDVGSN-QRGHLMKCSA-N |
| XLogP | 1.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate?
The IUPAC name of [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate (CID 156899526) is [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate.
What is the SMILES notation for [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate?
The canonical SMILES for [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate is C[C@H](OC(=O)NC/C=C/CN)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate?
The InChIKey is JZUTYMVXCDVGSN-QRGHLMKCSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-11(12-7-3-2-4-8-12)17-13(16)15-10-6-5-9-14/h2-8,11H,9-10,14H2,1H3,(H,15,16)/b6-5+/t11-/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate?
[(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate has a molecular weight of 234.30 g/mol, XLogP of 1.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] N-[(E)-4-aminobut-2-enyl]carbamate is sourced from PubChem (CID 156899526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).