About 1-phenylethyl 3-amino-2-hydroxypropanoate
1-phenylethyl 3-amino-2-hydroxypropanoate (PubChem CID 66164983) has the molecular formula C11H15NO3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-phenylethyl 3-amino-2-hydroxypropanoate.
Molecular Properties
| Compound Name | 1-phenylethyl 3-amino-2-hydroxypropanoate |
| PubChem CID | 66164983 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-phenylethyl 3-amino-2-hydroxypropanoate |
| SMILES | CC(OC(=O)C(O)CN)c1ccccc1 |
| InChI | InChI=1S/C11H15NO3/c1-8(9-5-3-2-4-6-9)15-11(14)10(13)7-12/h2-6,8,10,13H,7,12H2,1H3 |
| InChIKey | VDDVMVXCYIBECI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenylethyl 3-amino-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 3-amino-2-hydroxypropanoate?
The IUPAC name of 1-phenylethyl 3-amino-2-hydroxypropanoate (CID 66164983) is 1-phenylethyl 3-amino-2-hydroxypropanoate.
What is the SMILES notation for 1-phenylethyl 3-amino-2-hydroxypropanoate?
The canonical SMILES for 1-phenylethyl 3-amino-2-hydroxypropanoate is CC(OC(=O)C(O)CN)c1ccccc1.
What is the InChIKey of 1-phenylethyl 3-amino-2-hydroxypropanoate?
The InChIKey is VDDVMVXCYIBECI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-8(9-5-3-2-4-6-9)15-11(14)10(13)7-12/h2-6,8,10,13H,7,12H2,1H3.
What are the key properties of 1-phenylethyl 3-amino-2-hydroxypropanoate?
1-phenylethyl 3-amino-2-hydroxypropanoate has a molecular weight of 209.25 g/mol, XLogP of 0.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 3-amino-2-hydroxypropanoate is sourced from PubChem (CID 66164983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).