About [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate
[(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate (PubChem CID 11962000) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate |
| PubChem CID | 11962000 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate |
| SMILES | CC(OC(=O)[C@H](C)OC(=O)[C@H](C)O)c1ccccc1 |
| InChI | InChI=1S/C14H18O5/c1-9(15)13(16)19-11(3)14(17)18-10(2)12-7-5-4-6-8-12/h4-11,15H,1-3H3/t9-,10?,11-/m0/s1 |
| InChIKey | UUCVMGOLZNGBGP-JRUYECLLSA-N |
| XLogP | 1.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate?
The IUPAC name of [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate (CID 11962000) is [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate.
What is the SMILES notation for [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate?
The canonical SMILES for [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate is CC(OC(=O)[C@H](C)OC(=O)[C@H](C)O)c1ccccc1.
What is the InChIKey of [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate?
The InChIKey is UUCVMGOLZNGBGP-JRUYECLLSA-N. The full InChI is InChI=1S/C14H18O5/c1-9(15)13(16)19-11(3)14(17)18-10(2)12-7-5-4-6-8-12/h4-11,15H,1-3H3/t9-,10?,11-/m0/s1.
What are the key properties of [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate?
[(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate has a molecular weight of 266.29 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-oxo-1-(1-phenylethoxy)propan-2-yl] (2S)-2-hydroxypropanoate is sourced from PubChem (CID 11962000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).