About [(1R)-1-phenylethyl] 2-aminobutanoate
[(1R)-1-phenylethyl] 2-aminobutanoate (PubChem CID 175076698) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] 2-aminobutanoate.
Molecular Properties
| Compound Name | [(1R)-1-phenylethyl] 2-aminobutanoate |
| PubChem CID | 175076698 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | [(1R)-1-phenylethyl] 2-aminobutanoate |
| SMILES | CCC(N)C(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c1-3-11(13)12(14)15-9(2)10-7-5-4-6-8-10/h4-9,11H,3,13H2,1-2H3/t9-,11?/m1/s1 |
| InChIKey | WFTOVNAGQPOXLS-BFHBGLAWSA-N |
| XLogP | 2.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R)-1-phenylethyl] 2-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-phenylethyl] 2-aminobutanoate?
The IUPAC name of [(1R)-1-phenylethyl] 2-aminobutanoate (CID 175076698) is [(1R)-1-phenylethyl] 2-aminobutanoate.
What is the SMILES notation for [(1R)-1-phenylethyl] 2-aminobutanoate?
The canonical SMILES for [(1R)-1-phenylethyl] 2-aminobutanoate is CCC(N)C(=O)O[C@H](C)c1ccccc1.
What is the InChIKey of [(1R)-1-phenylethyl] 2-aminobutanoate?
The InChIKey is WFTOVNAGQPOXLS-BFHBGLAWSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-11(13)12(14)15-9(2)10-7-5-4-6-8-10/h4-9,11H,3,13H2,1-2H3/t9-,11?/m1/s1.
What are the key properties of [(1R)-1-phenylethyl] 2-aminobutanoate?
[(1R)-1-phenylethyl] 2-aminobutanoate has a molecular weight of 207.27 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-phenylethyl] 2-aminobutanoate is sourced from PubChem (CID 175076698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).