About [chloro(phenyl)methyl] 2-hydroxypropanoate
[chloro(phenyl)methyl] 2-hydroxypropanoate (PubChem CID 69060482) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is [chloro(phenyl)methyl] 2-hydroxypropanoate.
Molecular Properties
| Compound Name | [chloro(phenyl)methyl] 2-hydroxypropanoate |
| PubChem CID | 69060482 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | [chloro(phenyl)methyl] 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OC(Cl)c1ccccc1 |
| InChI | InChI=1S/C10H11ClO3/c1-7(12)10(13)14-9(11)8-5-3-2-4-6-8/h2-7,9,12H,1H3 |
| InChIKey | KAXYEUWPTIXIRQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [chloro(phenyl)methyl] 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(phenyl)methyl] 2-hydroxypropanoate?
The IUPAC name of [chloro(phenyl)methyl] 2-hydroxypropanoate (CID 69060482) is [chloro(phenyl)methyl] 2-hydroxypropanoate.
What is the SMILES notation for [chloro(phenyl)methyl] 2-hydroxypropanoate?
The canonical SMILES for [chloro(phenyl)methyl] 2-hydroxypropanoate is CC(O)C(=O)OC(Cl)c1ccccc1.
What is the InChIKey of [chloro(phenyl)methyl] 2-hydroxypropanoate?
The InChIKey is KAXYEUWPTIXIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c1-7(12)10(13)14-9(11)8-5-3-2-4-6-8/h2-7,9,12H,1H3.
What are the key properties of [chloro(phenyl)methyl] 2-hydroxypropanoate?
[chloro(phenyl)methyl] 2-hydroxypropanoate has a molecular weight of 214.65 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(phenyl)methyl] 2-hydroxypropanoate is sourced from PubChem (CID 69060482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).