About [chloro(phenyl)methyl] 3-methylbutanoate
[chloro(phenyl)methyl] 3-methylbutanoate (PubChem CID 172567471) has the molecular formula C12H15ClO2
and a molecular weight of 226.70 g/mol. Its IUPAC name is [chloro(phenyl)methyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [chloro(phenyl)methyl] 3-methylbutanoate |
| PubChem CID | 172567471 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [chloro(phenyl)methyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H15ClO2/c1-9(2)8-11(14)15-12(13)10-6-4-3-5-7-10/h3-7,9,12H,8H2,1-2H3 |
| InChIKey | VMVQIYYVMJQUED-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [chloro(phenyl)methyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(phenyl)methyl] 3-methylbutanoate?
The IUPAC name of [chloro(phenyl)methyl] 3-methylbutanoate (CID 172567471) is [chloro(phenyl)methyl] 3-methylbutanoate.
What is the SMILES notation for [chloro(phenyl)methyl] 3-methylbutanoate?
The canonical SMILES for [chloro(phenyl)methyl] 3-methylbutanoate is CC(C)CC(=O)OC(Cl)c1ccccc1.
What is the InChIKey of [chloro(phenyl)methyl] 3-methylbutanoate?
The InChIKey is VMVQIYYVMJQUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO2/c1-9(2)8-11(14)15-12(13)10-6-4-3-5-7-10/h3-7,9,12H,8H2,1-2H3.
What are the key properties of [chloro(phenyl)methyl] 3-methylbutanoate?
[chloro(phenyl)methyl] 3-methylbutanoate has a molecular weight of 226.70 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(phenyl)methyl] 3-methylbutanoate is sourced from PubChem (CID 172567471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).