C34H48N4O8 — CID 90979359
2,3-dimethoxy-N,N'-bis(1-phenylethyl)butanediamide;2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide (PubChem CID 90979359) has the molecular formula C34H48N4O8 and a molecular weight of 640.78 g/mol. Its IUPAC name is 2,3-dimethoxy-N,N'-bis(1-phenylethyl)butanediamide;2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide.
| Compound Name | 2,3-dimethoxy-N,N'-bis(1-phenylethyl)butanediamide;2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 90979359 |
| Molecular Formula | C34H48N4O8 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | 2,3-dimethoxy-N,N'-bis(1-phenylethyl)butanediamide;2,3-dimethoxy-N,N'-bis(prop-2-enyl)butanediamide |
| SMILES | C=CCNC(=O)C(OC)C(OC)C(=O)NCC=C.COC(C(=O)NC(C)c1ccccc1)C(OC)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O4.C12H20N2O4/c1-15(17-11-7-5-8-12-17)23-21(25)19(27-3)20(28-4)22(26)24-16(2)18-13-9-6-10-14-18;1-5-7-13-11(15)9(17-3)10(18-4)12(16)14-8-6-2/h5-16,19-20H,1-4H3,(H,23,25)(H,24,26);5-6,9-10H,1-2,7-8H2,3-4H3,(H,13,15)(H,14,16) |
| InChIKey | JPMMWVWJUBFPQO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|