C24H28N2O4 — CID 70218763
(2R,3R)-2,3-bis(phenylmethoxy)-N,N'-bis(prop-2-enyl)butanediamide (PubChem CID 70218763) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(phenylmethoxy)-N,N'-bis(prop-2-enyl)butanediamide.
| Compound Name | (2R,3R)-2,3-bis(phenylmethoxy)-N,N'-bis(prop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 70218763 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (2R,3R)-2,3-bis(phenylmethoxy)-N,N'-bis(prop-2-enyl)butanediamide |
| SMILES | C=CCNC(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)NCC=C |
| InChI | InChI=1S/C24H28N2O4/c1-3-15-25-23(27)21(29-17-19-11-7-5-8-12-19)22(24(28)26-16-4-2)30-18-20-13-9-6-10-14-20/h3-14,21-22H,1-2,15-18H2,(H,25,27)(H,26,28)/t21-,22-/m1/s1 |
| InChIKey | IAKNXIWRJWCTDW-FGZHOGPDSA-N |
| XLogP | 2.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|