C24H24N2O6 — CID 18330840
[3-benzoyloxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] benzoate (PubChem CID 18330840) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is [3-benzoyloxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] benzoate.
| Compound Name | [3-benzoyloxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] benzoate |
|---|---|
| PubChem CID | 18330840 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [3-benzoyloxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] benzoate |
| SMILES | C=CCNC(=O)C(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C(=O)NCC=C |
| InChI | InChI=1S/C24H24N2O6/c1-3-15-25-21(27)19(31-23(29)17-11-7-5-8-12-17)20(22(28)26-16-4-2)32-24(30)18-13-9-6-10-14-18/h3-14,19-20H,1-2,15-16H2,(H,25,27)(H,26,28) |
| InChIKey | CFQXZNAMZBKQKQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|