C14H19NO3S — CID 53350098
3,3-dimethoxy-2-phenylsulfanyl-N-prop-2-enylpropanamide (PubChem CID 53350098) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3,3-dimethoxy-2-phenylsulfanyl-N-prop-2-enylpropanamide.
| Compound Name | 3,3-dimethoxy-2-phenylsulfanyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 53350098 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3,3-dimethoxy-2-phenylsulfanyl-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(Sc1ccccc1)C(OC)OC |
| InChI | InChI=1S/C14H19NO3S/c1-4-10-15-13(16)12(14(17-2)18-3)19-11-8-6-5-7-9-11/h4-9,12,14H,1,10H2,2-3H3,(H,15,16) |
| InChIKey | URHMVFLTTZEOJF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|