C16H21NO3S — CID 53348913
2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]-2-phenylsulfanyl-N-prop-2-enylacetamide (PubChem CID 53348913) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]-2-phenylsulfanyl-N-prop-2-enylacetamide.
| Compound Name | 2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]-2-phenylsulfanyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 53348913 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]-2-phenylsulfanyl-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(Sc1ccccc1)C1O[C@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C16H21NO3S/c1-4-10-17-15(18)14(16-19-11(2)12(3)20-16)21-13-8-6-5-7-9-13/h4-9,11-12,14,16H,1,10H2,2-3H3,(H,17,18)/t11-,12-,14?/m1/s1 |
| InChIKey | ISQDQMUDBGNLFC-QAYQGLBKSA-N |
| XLogP | 2.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|