C9H15NO3 — CID 58883098
2,3-dimethyl-4-oxo-4-(prop-2-enylamino)butanoic acid (PubChem CID 58883098) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-(prop-2-enylamino)butanoic acid.
| Compound Name | 2,3-dimethyl-4-oxo-4-(prop-2-enylamino)butanoic acid |
|---|---|
| PubChem CID | 58883098 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2,3-dimethyl-4-oxo-4-(prop-2-enylamino)butanoic acid |
| SMILES | C=CCNC(=O)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C9H15NO3/c1-4-5-10-8(11)6(2)7(3)9(12)13/h4,6-7H,1,5H2,2-3H3,(H,10,11)(H,12,13) |
| InChIKey | UAJUWQNTRGPPLE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|