C8H15NO — CID 20811204
2-methyl-N-prop-2-enylbutanamide (PubChem CID 20811204) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 2-methyl-N-prop-2-enylbutanamide.
| Compound Name | 2-methyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 20811204 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2-methyl-N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)C(C)CC |
| InChI | InChI=1S/C8H15NO/c1-4-6-9-8(10)7(3)5-2/h4,7H,1,5-6H2,2-3H3,(H,9,10) |
| InChIKey | GVVFYKIGWUPNFN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|