C9H14N2O3 — CID 59934483
2-hydroxy-N,N'-bis(prop-2-enyl)propanediamide (PubChem CID 59934483) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-hydroxy-N,N'-bis(prop-2-enyl)propanediamide.
| Compound Name | 2-hydroxy-N,N'-bis(prop-2-enyl)propanediamide |
|---|---|
| PubChem CID | 59934483 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-hydroxy-N,N'-bis(prop-2-enyl)propanediamide |
| SMILES | C=CCNC(=O)C(O)C(=O)NCC=C |
| InChI | InChI=1S/C9H14N2O3/c1-3-5-10-8(13)7(12)9(14)11-6-4-2/h3-4,7,12H,1-2,5-6H2,(H,10,13)(H,11,14) |
| InChIKey | NJAIDYVXPYAXQK-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|