C6H11NO3 — CID 87997467
2,3-dihydroxy-N-prop-2-enylpropanamide (PubChem CID 87997467) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2,3-dihydroxy-N-prop-2-enylpropanamide.
| Compound Name | 2,3-dihydroxy-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 87997467 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2,3-dihydroxy-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(O)CO |
| InChI | InChI=1S/C6H11NO3/c1-2-3-7-6(10)5(9)4-8/h2,5,8-9H,1,3-4H2,(H,7,10) |
| InChIKey | UEWQAGHVGOUTOS-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|