C11H17ClN2O2 — CID 126612629
2-(2-chloroethyl)-N,N'-bis(prop-2-enyl)propanediamide (PubChem CID 126612629) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-(2-chloroethyl)-N,N'-bis(prop-2-enyl)propanediamide.
| Compound Name | 2-(2-chloroethyl)-N,N'-bis(prop-2-enyl)propanediamide |
|---|---|
| PubChem CID | 126612629 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(2-chloroethyl)-N,N'-bis(prop-2-enyl)propanediamide |
| SMILES | C=CCNC(=O)C(CCCl)C(=O)NCC=C |
| InChI | InChI=1S/C11H17ClN2O2/c1-3-7-13-10(15)9(5-6-12)11(16)14-8-4-2/h3-4,9H,1-2,5-8H2,(H,13,15)(H,14,16) |
| InChIKey | XVFJUCCJVJUWBW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|