C9H19ClN2O2 — CID 139291083
3-amino-2-hydroxy-N-prop-2-enylhexanamide;hydrochloride (PubChem CID 139291083) has the molecular formula C9H19ClN2O2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 3-amino-2-hydroxy-N-prop-2-enylhexanamide;hydrochloride.
| Compound Name | 3-amino-2-hydroxy-N-prop-2-enylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 139291083 |
| Molecular Formula | C9H19ClN2O2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-amino-2-hydroxy-N-prop-2-enylhexanamide;hydrochloride |
| SMILES | C=CCNC(=O)C(O)C(N)CCC.Cl |
| InChI | InChI=1S/C9H18N2O2.ClH/c1-3-5-7(10)8(12)9(13)11-6-4-2;/h4,7-8,12H,2-3,5-6,10H2,1H3,(H,11,13);1H |
| InChIKey | KSUBPSSEKRSVTB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|