C8H20Cl2N2O2 — CID 86762425
(2S,3S)-3-amino-N-ethyl-2-hydroxyhexanamide;dihydrochloride (PubChem CID 86762425) has the molecular formula C8H20Cl2N2O2 and a molecular weight of 247.17 g/mol. Its IUPAC name is (2S,3S)-3-amino-N-ethyl-2-hydroxyhexanamide;dihydrochloride.
| Compound Name | (2S,3S)-3-amino-N-ethyl-2-hydroxyhexanamide;dihydrochloride |
|---|---|
| PubChem CID | 86762425 |
| Molecular Formula | C8H20Cl2N2O2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2S,3S)-3-amino-N-ethyl-2-hydroxyhexanamide;dihydrochloride |
| SMILES | CCC[C@H](N)[C@H](O)C(=O)NCC.Cl.Cl |
| InChI | InChI=1S/C8H18N2O2.2ClH/c1-3-5-6(9)7(11)8(12)10-4-2;;/h6-7,11H,3-5,9H2,1-2H3,(H,10,12);2*1H/t6-,7-;;/m0../s1 |
| InChIKey | FKCRWJRQWGLCKK-JFYKYWLVSA-N |
| XLogP | 0.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |