C7H15N3O2 — CID 88901749
2-amino-N,N'-diethylpropanediamide (PubChem CID 88901749) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-amino-N,N'-diethylpropanediamide.
| Compound Name | 2-amino-N,N'-diethylpropanediamide |
|---|---|
| PubChem CID | 88901749 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-amino-N,N'-diethylpropanediamide |
| SMILES | CCNC(=O)C(N)C(=O)NCC |
| InChI | InChI=1S/C7H15N3O2/c1-3-9-6(11)5(8)7(12)10-4-2/h5H,3-4,8H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | AMGZBZMBZCUEPO-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|