C7H15N3O4 — CID 173250932
2-amino-N,N'-bis(2-hydroxyethyl)propanediamide (PubChem CID 173250932) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-amino-N,N'-bis(2-hydroxyethyl)propanediamide.
| Compound Name | 2-amino-N,N'-bis(2-hydroxyethyl)propanediamide |
|---|---|
| PubChem CID | 173250932 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-amino-N,N'-bis(2-hydroxyethyl)propanediamide |
| SMILES | NC(C(=O)NCCO)C(=O)NCCO |
| InChI | InChI=1S/C7H15N3O4/c8-5(6(13)9-1-3-11)7(14)10-2-4-12/h5,11-12H,1-4,8H2,(H,9,13)(H,10,14) |
| InChIKey | BGTGSTOQGSVPOR-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|