C4H7Cl2NO2 — CID 5228722
2,2-dichloro-N-(2-hydroxyethyl)acetamide (PubChem CID 5228722) has the molecular formula C4H7Cl2NO2 and a molecular weight of 172.01 g/mol. Its IUPAC name is 2,2-dichloro-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2,2-dichloro-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 5228722 |
| Molecular Formula | C4H7Cl2NO2 |
| Molecular Weight | 172.01 g/mol |
| Exact Mass | 170.99 |
| IUPAC Name | 2,2-dichloro-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(NCCO)C(Cl)Cl |
| InChI | InChI=1S/C4H7Cl2NO2/c5-3(6)4(9)7-1-2-8/h3,8H,1-2H2,(H,7,9) |
| InChIKey | JYWGZDGPDBDTAN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.01 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|