C6H11Cl2NO2 — CID 3598343
2,2-dichloro-N-(3-methoxypropyl)acetamide (PubChem CID 3598343) has the molecular formula C6H11Cl2NO2 and a molecular weight of 200.06 g/mol. Its IUPAC name is 2,2-dichloro-N-(3-methoxypropyl)acetamide.
| Compound Name | 2,2-dichloro-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 3598343 |
| Molecular Formula | C6H11Cl2NO2 |
| Molecular Weight | 200.06 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 2,2-dichloro-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)C(Cl)Cl |
| InChI | InChI=1S/C6H11Cl2NO2/c1-11-4-2-3-9-6(10)5(7)8/h5H,2-4H2,1H3,(H,9,10) |
| InChIKey | VBRBHTFROMNBPH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.06 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|