C9H16Cl2N2O3 — CID 132968892
methyl (2S)-2-amino-6-[(2,2-dichloroacetyl)amino]hexanoate (PubChem CID 132968892) has the molecular formula C9H16Cl2N2O3 and a molecular weight of 271.14 g/mol. Its IUPAC name is methyl (2S)-2-amino-6-[(2,2-dichloroacetyl)amino]hexanoate.
| Compound Name | methyl (2S)-2-amino-6-[(2,2-dichloroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 132968892 |
| Molecular Formula | C9H16Cl2N2O3 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | methyl (2S)-2-amino-6-[(2,2-dichloroacetyl)amino]hexanoate |
| SMILES | COC(=O)[C@@H](N)CCCCNC(=O)C(Cl)Cl |
| InChI | InChI=1S/C9H16Cl2N2O3/c1-16-9(15)6(12)4-2-3-5-13-8(14)7(10)11/h6-7H,2-5,12H2,1H3,(H,13,14)/t6-/m0/s1 |
| InChIKey | ASCPMSDRSRREPZ-LURJTMIESA-N |
| XLogP | 0.58 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|