C15H22Cl2N2O4 — CID 46243155
methyl (2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoate;hydrochloride (PubChem CID 46243155) has the molecular formula C15H22Cl2N2O4 and a molecular weight of 365.26 g/mol. Its IUPAC name is methyl (2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoate;hydrochloride |
|---|---|
| PubChem CID | 46243155 |
| Molecular Formula | C15H22Cl2N2O4 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | methyl (2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C15H21ClN2O4.ClH/c1-21-14(19)13(17)8-4-5-9-18-15(20)22-10-11-6-2-3-7-12(11)16;/h2-3,6-7,13H,4-5,8-10,17H2,1H3,(H,18,20);1H/t13-;/m0./s1 |
| InChIKey | XGFWHPYFHVMVPI-ZOWNYOTGSA-N |
| XLogP | 2.66 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|