C16H21ClN2O4 — CID 138585760
2-amino-6-[(2-ethynylphenyl)methoxycarbonylamino]hexanoic acid;hydrochloride (PubChem CID 138585760) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is 2-amino-6-[(2-ethynylphenyl)methoxycarbonylamino]hexanoic acid;hydrochloride.
| Compound Name | 2-amino-6-[(2-ethynylphenyl)methoxycarbonylamino]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 138585760 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-amino-6-[(2-ethynylphenyl)methoxycarbonylamino]hexanoic acid;hydrochloride |
| SMILES | C#Cc1ccccc1COC(=O)NCCCCC(N)C(=O)O.Cl |
| InChI | InChI=1S/C16H20N2O4.ClH/c1-2-12-7-3-4-8-13(12)11-22-16(21)18-10-6-5-9-14(17)15(19)20;/h1,3-4,7-8,14H,5-6,9-11,17H2,(H,18,21)(H,19,20);1H |
| InChIKey | UKUMOLUASVOXCZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|