C14H19N5O4 — CID 89499050
(2S)-2-amino-6-[(2-azidophenyl)methoxycarbonylamino]hexanoic acid (PubChem CID 89499050) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is (2S)-2-amino-6-[(2-azidophenyl)methoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(2-azidophenyl)methoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 89499050 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (2S)-2-amino-6-[(2-azidophenyl)methoxycarbonylamino]hexanoic acid |
| SMILES | [N-]=[N+]=Nc1ccccc1COC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H19N5O4/c15-11(13(20)21)6-3-4-8-17-14(22)23-9-10-5-1-2-7-12(10)18-19-16/h1-2,5,7,11H,3-4,6,8-9,15H2,(H,17,22)(H,20,21)/t11-/m0/s1 |
| InChIKey | PGNICAOCNIVZRV-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 150.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|