C9H17N5O5 — CID 141454494
(2S)-2-amino-6-(2-azidoethylperoxycarbonylamino)hexanoic acid (PubChem CID 141454494) has the molecular formula C9H17N5O5 and a molecular weight of 275.27 g/mol. Its IUPAC name is (2S)-2-amino-6-(2-azidoethylperoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-amino-6-(2-azidoethylperoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 141454494 |
| Molecular Formula | C9H17N5O5 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (2S)-2-amino-6-(2-azidoethylperoxycarbonylamino)hexanoic acid |
| SMILES | [N-]=[N+]=NCCOOC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H17N5O5/c10-7(8(15)16)3-1-2-4-12-9(17)19-18-6-5-13-14-11/h7H,1-6,10H2,(H,12,17)(H,15,16)/t7-/m0/s1 |
| InChIKey | GTRCFEDVFVYECH-ZETCQYMHSA-N |
| XLogP | 0.54 |
| TPSA | 159.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|